C24H29BrF4N2O2SSi — CID 90221740
N-[[(2R,3R)-2-(5-bromo-2-fluorophenyl)-4-[tert-butyl(dimethyl)silyl]oxy-1,1,3-trifluorobutan-2-yl]carbamothioyl]benzamide (PubChem CID 90221740) has the molecular formula C24H29BrF4N2O2SSi and a molecular weight of 593.56 g/mol. Its IUPAC name is N-[[(2R,3R)-2-(5-bromo-2-fluorophenyl)-4-[tert-butyl(dimethyl)silyl]oxy-1,1,3-trifluorobutan-2-yl]carbamothioyl]benzamide.
| Compound Name | N-[[(2R,3R)-2-(5-bromo-2-fluorophenyl)-4-[tert-butyl(dimethyl)silyl]oxy-1,1,3-trifluorobutan-2-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 90221740 |
| Molecular Formula | C24H29BrF4N2O2SSi |
| Molecular Weight | 593.56 g/mol |
| Exact Mass | 592.08 |
| IUPAC Name | N-[[(2R,3R)-2-(5-bromo-2-fluorophenyl)-4-[tert-butyl(dimethyl)silyl]oxy-1,1,3-trifluorobutan-2-yl]carbamothioyl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](F)[C@](NC(=S)NC(=O)c1ccccc1)(c1cc(Br)ccc1F)C(F)F |
| InChI | InChI=1S/C24H29BrF4N2O2SSi/c1-23(2,3)35(4,5)33-14-19(27)24(21(28)29,17-13-16(25)11-12-18(17)26)31-22(34)30-20(32)15-9-7-6-8-10-15/h6-13,19,21H,14H2,1-5H3,(H2,30,31,32,34)/t19-,24+/m0/s1 |
| InChIKey | BQZVQMRQGGEMLN-YADARESESA-N |
| XLogP | 6.71 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.56 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|