C25H40BrFN2O3SSi — CID 131743613
tert-butyl N-[(2R)-2-(5-bromo-2-fluorophenyl)-6-[tert-butyl(dimethyl)silyl]oxy-3-(cyanomethylsulfanyl)hexan-2-yl]carbamate (PubChem CID 131743613) has the molecular formula C25H40BrFN2O3SSi and a molecular weight of 575.66 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-(5-bromo-2-fluorophenyl)-6-[tert-butyl(dimethyl)silyl]oxy-3-(cyanomethylsulfanyl)hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-(5-bromo-2-fluorophenyl)-6-[tert-butyl(dimethyl)silyl]oxy-3-(cyanomethylsulfanyl)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 131743613 |
| Molecular Formula | C25H40BrFN2O3SSi |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | tert-butyl N-[(2R)-2-(5-bromo-2-fluorophenyl)-6-[tert-butyl(dimethyl)silyl]oxy-3-(cyanomethylsulfanyl)hexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@](C)(c1cc(Br)ccc1F)C(CCCO[Si](C)(C)C(C)(C)C)SCC#N |
| InChI | InChI=1S/C25H40BrFN2O3SSi/c1-23(2,3)32-22(30)29-25(7,19-17-18(26)12-13-20(19)27)21(33-16-14-28)11-10-15-31-34(8,9)24(4,5)6/h12-13,17,21H,10-11,15-16H2,1-9H3,(H,29,30)/t21?,25-/m1/s1 |
| InChIKey | UTBBXEMWYJJQMD-UIDYPRJRSA-N |
| XLogP | 7.76 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|