C31H43F6NO4Si — CID 53330429
tert-butyl N-[(1R,2R)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-[tert-butyl(dimethyl)silyl]oxy-1-phenylpentyl]carbamate (PubChem CID 53330429) has the molecular formula C31H43F6NO4Si and a molecular weight of 635.76 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-[tert-butyl(dimethyl)silyl]oxy-1-phenylpentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-[tert-butyl(dimethyl)silyl]oxy-1-phenylpentyl]carbamate |
|---|---|
| PubChem CID | 53330429 |
| Molecular Formula | C31H43F6NO4Si |
| Molecular Weight | 635.76 g/mol |
| Exact Mass | 635.29 |
| IUPAC Name | tert-butyl N-[(1R,2R)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5-[tert-butyl(dimethyl)silyl]oxy-1-phenylpentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(c1ccccc1)[C@@H](CCCO[Si](C)(C)C(C)(C)C)OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H43F6NO4Si/c1-28(2,3)42-27(39)38-26(22-13-10-9-11-14-22)25(15-12-16-41-43(7,8)29(4,5)6)40-20-21-17-23(30(32,33)34)19-24(18-21)31(35,36)37/h9-11,13-14,17-19,25-26H,12,15-16,20H2,1-8H3,(H,38,39)/t25-,26?/m1/s1 |
| InChIKey | MLUVBBOQSXIASK-DCWQJPKNSA-N |
| XLogP | 9.68 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.76 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|