C27H36F6O — CID 143529326
pentane;1-(2-phenylheptan-3-yloxymethyl)-3,5-bis(trifluoromethyl)benzene (PubChem CID 143529326) has the molecular formula C27H36F6O and a molecular weight of 490.57 g/mol. Its IUPAC name is pentane;1-(2-phenylheptan-3-yloxymethyl)-3,5-bis(trifluoromethyl)benzene.
| Compound Name | pentane;1-(2-phenylheptan-3-yloxymethyl)-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 143529326 |
| Molecular Formula | C27H36F6O |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | pentane;1-(2-phenylheptan-3-yloxymethyl)-3,5-bis(trifluoromethyl)benzene |
| SMILES | CCCCC.CCCCC(OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(C)c1ccccc1 |
| InChI | InChI=1S/C22H24F6O.C5H12/c1-3-4-10-20(15(2)17-8-6-5-7-9-17)29-14-16-11-18(21(23,24)25)13-19(12-16)22(26,27)28;1-3-5-4-2/h5-9,11-13,15,20H,3-4,10,14H2,1-2H3;3-5H2,1-2H3 |
| InChIKey | MZTGGOLPLSDQNT-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |