C15H20F6O — CID 143627234
1-[3,5-bis(trifluoromethyl)phenyl]ethanol;pentane (PubChem CID 143627234) has the molecular formula C15H20F6O and a molecular weight of 330.31 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]ethanol;pentane.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]ethanol;pentane |
|---|---|
| PubChem CID | 143627234 |
| Molecular Formula | C15H20F6O |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]ethanol;pentane |
| SMILES | CC(O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.CCCCC |
| InChI | InChI=1S/C10H8F6O.C5H12/c1-5(17)6-2-7(9(11,12)13)4-8(3-6)10(14,15)16;1-3-5-4-2/h2-5,17H,1H3;3-5H2,1-2H3 |
| InChIKey | OXOQVLWIJKKXHH-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |