C19H26F6 — CID 130251073
1-(3-ethyl-3-methyloctan-2-yl)-3,5-bis(trifluoromethyl)benzene (PubChem CID 130251073) has the molecular formula C19H26F6 and a molecular weight of 368.41 g/mol. Its IUPAC name is 1-(3-ethyl-3-methyloctan-2-yl)-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-(3-ethyl-3-methyloctan-2-yl)-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 130251073 |
| Molecular Formula | C19H26F6 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 1-(3-ethyl-3-methyloctan-2-yl)-3,5-bis(trifluoromethyl)benzene |
| SMILES | CCCCCC(C)(CC)C(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H26F6/c1-5-7-8-9-17(4,6-2)13(3)14-10-15(18(20,21)22)12-16(11-14)19(23,24)25/h10-13H,5-9H2,1-4H3 |
| InChIKey | ZHEFLWBYTADVKB-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|