C13H13BrF6 — CID 79308013
1-(3-bromopentan-2-yl)-3,5-bis(trifluoromethyl)benzene (PubChem CID 79308013) has the molecular formula C13H13BrF6 and a molecular weight of 363.14 g/mol. Its IUPAC name is 1-(3-bromopentan-2-yl)-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-(3-bromopentan-2-yl)-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 79308013 |
| Molecular Formula | C13H13BrF6 |
| Molecular Weight | 363.14 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 1-(3-bromopentan-2-yl)-3,5-bis(trifluoromethyl)benzene |
| SMILES | CCC(Br)C(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13BrF6/c1-3-11(14)7(2)8-4-9(12(15,16)17)6-10(5-8)13(18,19)20/h4-7,11H,3H2,1-2H3 |
| InChIKey | MJPPLKNSVQBHNI-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.14 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|