C15H17F6I — CID 134472031
1-(5-iodo-2-methylhexan-3-yl)-3,5-bis(trifluoromethyl)benzene (PubChem CID 134472031) has the molecular formula C15H17F6I and a molecular weight of 438.19 g/mol. Its IUPAC name is 1-(5-iodo-2-methylhexan-3-yl)-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-(5-iodo-2-methylhexan-3-yl)-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 134472031 |
| Molecular Formula | C15H17F6I |
| Molecular Weight | 438.19 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 1-(5-iodo-2-methylhexan-3-yl)-3,5-bis(trifluoromethyl)benzene |
| SMILES | CC(I)CC(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(C)C |
| InChI | InChI=1S/C15H17F6I/c1-8(2)13(4-9(3)22)10-5-11(14(16,17)18)7-12(6-10)15(19,20)21/h5-9,13H,4H2,1-3H3 |
| InChIKey | UODUYZYXTYYLGF-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.19 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|