C15H21F3 — CID 144748476
1-(2,5-dimethylhexan-3-yl)-4-(trifluoromethyl)benzene (PubChem CID 144748476) has the molecular formula C15H21F3 and a molecular weight of 258.33 g/mol. Its IUPAC name is 1-(2,5-dimethylhexan-3-yl)-4-(trifluoromethyl)benzene.
| Compound Name | 1-(2,5-dimethylhexan-3-yl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 144748476 |
| Molecular Formula | C15H21F3 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 1-(2,5-dimethylhexan-3-yl)-4-(trifluoromethyl)benzene |
| SMILES | CC(C)CC(c1ccc(C(F)(F)F)cc1)C(C)C |
| InChI | InChI=1S/C15H21F3/c1-10(2)9-14(11(3)4)12-5-7-13(8-6-12)15(16,17)18/h5-8,10-11,14H,9H2,1-4H3 |
| InChIKey | LRILVTLVNOSBOD-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |