C15H24O — CID 58807001
[4-(2,5-dimethylhexan-3-yl)phenyl]methanol (PubChem CID 58807001) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is [4-(2,5-dimethylhexan-3-yl)phenyl]methanol.
| Compound Name | [4-(2,5-dimethylhexan-3-yl)phenyl]methanol |
|---|---|
| PubChem CID | 58807001 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | [4-(2,5-dimethylhexan-3-yl)phenyl]methanol |
| SMILES | CC(C)CC(c1ccc(CO)cc1)C(C)C |
| InChI | InChI=1S/C15H24O/c1-11(2)9-15(12(3)4)14-7-5-13(10-16)6-8-14/h5-8,11-12,15-16H,9-10H2,1-4H3 |
| InChIKey | BLGODMZFCDQZLA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |