C12H9ClF6O — CID 23225989
2-[3,5-bis(trifluoromethyl)phenyl]butanoyl chloride (PubChem CID 23225989) has the molecular formula C12H9ClF6O and a molecular weight of 318.64 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]butanoyl chloride.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]butanoyl chloride |
|---|---|
| PubChem CID | 23225989 |
| Molecular Formula | C12H9ClF6O |
| Molecular Weight | 318.64 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]butanoyl chloride |
| SMILES | CCC(C(=O)Cl)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H9ClF6O/c1-2-9(10(13)20)6-3-7(11(14,15)16)5-8(4-6)12(17,18)19/h3-5,9H,2H2,1H3 |
| InChIKey | CHPGREXTXDHWKR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.64 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|