C12H11F6NO3 — CID 53363737
(1R,2R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-nitrobutan-1-ol (PubChem CID 53363737) has the molecular formula C12H11F6NO3 and a molecular weight of 331.21 g/mol. Its IUPAC name is (1R,2R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-nitrobutan-1-ol.
| Compound Name | (1R,2R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-nitrobutan-1-ol |
|---|---|
| PubChem CID | 53363737 |
| Molecular Formula | C12H11F6NO3 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | (1R,2R)-1-[3,5-bis(trifluoromethyl)phenyl]-2-nitrobutan-1-ol |
| SMILES | CC[C@H]([C@H](O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)[N+](=O)[O-] |
| InChI | InChI=1S/C12H11F6NO3/c1-2-9(19(21)22)10(20)6-3-7(11(13,14)15)5-8(4-6)12(16,17)18/h3-5,9-10,20H,2H2,1H3/t9-,10-/m1/s1 |
| InChIKey | KTTAAYSEQKRKFA-NXEZZACHSA-N |
| XLogP | 3.81 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|