C12H13F3N2O5 — CID 170831023
N-[2,3-dihydroxy-3-[3-nitro-5-(trifluoromethyl)phenyl]propyl]acetamide (PubChem CID 170831023) has the molecular formula C12H13F3N2O5 and a molecular weight of 322.24 g/mol. Its IUPAC name is N-[2,3-dihydroxy-3-[3-nitro-5-(trifluoromethyl)phenyl]propyl]acetamide.
| Compound Name | N-[2,3-dihydroxy-3-[3-nitro-5-(trifluoromethyl)phenyl]propyl]acetamide |
|---|---|
| PubChem CID | 170831023 |
| Molecular Formula | C12H13F3N2O5 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N-[2,3-dihydroxy-3-[3-nitro-5-(trifluoromethyl)phenyl]propyl]acetamide |
| SMILES | CC(=O)NCC(O)C(O)c1cc([N+](=O)[O-])cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3N2O5/c1-6(18)16-5-10(19)11(20)7-2-8(12(13,14)15)4-9(3-7)17(21)22/h2-4,10-11,19-20H,5H2,1H3,(H,16,18) |
| InChIKey | RSXBZTZVGXJNSS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|