C14H16F6O — CID 83052238
2-[3,5-bis(trifluoromethyl)phenyl]hexan-3-ol (PubChem CID 83052238) has the molecular formula C14H16F6O and a molecular weight of 314.27 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]hexan-3-ol.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]hexan-3-ol |
|---|---|
| PubChem CID | 83052238 |
| Molecular Formula | C14H16F6O |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]hexan-3-ol |
| SMILES | CCCC(O)C(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F6O/c1-3-4-12(21)8(2)9-5-10(13(15,16)17)7-11(6-9)14(18,19)20/h5-8,12,21H,3-4H2,1-2H3 |
| InChIKey | LHCZDHOUGOXFHI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |