C18H25F6NS — CID 129162483
N-[[(2R)-nonan-2-yl]sulfanylmethyl]-3,5-bis(trifluoromethyl)aniline (PubChem CID 129162483) has the molecular formula C18H25F6NS and a molecular weight of 401.46 g/mol. Its IUPAC name is N-[[(2R)-nonan-2-yl]sulfanylmethyl]-3,5-bis(trifluoromethyl)aniline.
| Compound Name | N-[[(2R)-nonan-2-yl]sulfanylmethyl]-3,5-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 129162483 |
| Molecular Formula | C18H25F6NS |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | N-[[(2R)-nonan-2-yl]sulfanylmethyl]-3,5-bis(trifluoromethyl)aniline |
| SMILES | CCCCCCC[C@@H](C)SCNc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H25F6NS/c1-3-4-5-6-7-8-13(2)26-12-25-16-10-14(17(19,20)21)9-15(11-16)18(22,23)24/h9-11,13,25H,3-8,12H2,1-2H3/t13-/m1/s1 |
| InChIKey | NFNUWAPCNXVCHP-CYBMUJFWSA-N |
| XLogP | 7.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|