C20H28F6O3 — CID 151231987
2-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]decane-1,1,1-triol (PubChem CID 151231987) has the molecular formula C20H28F6O3 and a molecular weight of 430.43 g/mol. Its IUPAC name is 2-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]decane-1,1,1-triol.
| Compound Name | 2-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]decane-1,1,1-triol |
|---|---|
| PubChem CID | 151231987 |
| Molecular Formula | C20H28F6O3 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 2-[2-[3,5-bis(trifluoromethyl)phenyl]ethyl]decane-1,1,1-triol |
| SMILES | CCCCCCCCC(CCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(O)(O)O |
| InChI | InChI=1S/C20H28F6O3/c1-2-3-4-5-6-7-8-15(20(27,28)29)10-9-14-11-16(18(21,22)23)13-17(12-14)19(24,25)26/h11-13,15,27-29H,2-10H2,1H3 |
| InChIKey | NOMFUASAKXWMRZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|