C27H42F6O — CID 151548210
1-[6-(2-ethoxypropan-2-yl)tetradecyl]-3,5-bis(trifluoromethyl)benzene (PubChem CID 151548210) has the molecular formula C27H42F6O and a molecular weight of 496.62 g/mol. Its IUPAC name is 1-[6-(2-ethoxypropan-2-yl)tetradecyl]-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-[6-(2-ethoxypropan-2-yl)tetradecyl]-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 151548210 |
| Molecular Formula | C27H42F6O |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.31 |
| IUPAC Name | 1-[6-(2-ethoxypropan-2-yl)tetradecyl]-3,5-bis(trifluoromethyl)benzene |
| SMILES | CCCCCCCCC(CCCCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(C)(C)OCC |
| InChI | InChI=1S/C27H42F6O/c1-5-7-8-9-10-13-16-22(25(3,4)34-6-2)17-14-11-12-15-21-18-23(26(28,29)30)20-24(19-21)27(31,32)33/h18-20,22H,5-17H2,1-4H3 |
| InChIKey | PZXFYFGESGOXLG-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|