C26H44F2O — CID 150994568
1-[7-(2-ethoxypropan-2-yl)pentadecyl]-3,5-difluorobenzene (PubChem CID 150994568) has the molecular formula C26H44F2O and a molecular weight of 410.63 g/mol. Its IUPAC name is 1-[7-(2-ethoxypropan-2-yl)pentadecyl]-3,5-difluorobenzene.
| Compound Name | 1-[7-(2-ethoxypropan-2-yl)pentadecyl]-3,5-difluorobenzene |
|---|---|
| PubChem CID | 150994568 |
| Molecular Formula | C26H44F2O |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | 1-[7-(2-ethoxypropan-2-yl)pentadecyl]-3,5-difluorobenzene |
| SMILES | CCCCCCCCC(CCCCCCc1cc(F)cc(F)c1)C(C)(C)OCC |
| InChI | InChI=1S/C26H44F2O/c1-5-7-8-9-10-14-17-23(26(3,4)29-6-2)18-15-12-11-13-16-22-19-24(27)21-25(28)20-22/h19-21,23H,5-18H2,1-4H3 |
| InChIKey | LSUYGACXICMIIN-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|