C28H49FO3 — CID 172751050
1-fluoro-3-[7-(triethoxymethyl)pentadecyl]benzene (PubChem CID 172751050) has the molecular formula C28H49FO3 and a molecular weight of 452.70 g/mol. Its IUPAC name is 1-fluoro-3-[7-(triethoxymethyl)pentadecyl]benzene.
| Compound Name | 1-fluoro-3-[7-(triethoxymethyl)pentadecyl]benzene |
|---|---|
| PubChem CID | 172751050 |
| Molecular Formula | C28H49FO3 |
| Molecular Weight | 452.70 g/mol |
| Exact Mass | 452.37 |
| IUPAC Name | 1-fluoro-3-[7-(triethoxymethyl)pentadecyl]benzene |
| SMILES | CCCCCCCCC(CCCCCCc1cccc(F)c1)C(OCC)(OCC)OCC |
| InChI | InChI=1S/C28H49FO3/c1-5-9-10-11-12-16-21-26(28(30-6-2,31-7-3)32-8-4)22-17-14-13-15-19-25-20-18-23-27(29)24-25/h18,20,23-24,26H,5-17,19,21-22H2,1-4H3 |
| InChIKey | KJKXIKADSPVJIJ-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.70 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|