C23H39FO3 — CID 152707471
1-[3-[dimethoxy(propan-2-yloxy)methyl]undecyl]-3-fluorobenzene (PubChem CID 152707471) has the molecular formula C23H39FO3 and a molecular weight of 382.56 g/mol. Its IUPAC name is 1-[3-[dimethoxy(propan-2-yloxy)methyl]undecyl]-3-fluorobenzene.
| Compound Name | 1-[3-[dimethoxy(propan-2-yloxy)methyl]undecyl]-3-fluorobenzene |
|---|---|
| PubChem CID | 152707471 |
| Molecular Formula | C23H39FO3 |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | 1-[3-[dimethoxy(propan-2-yloxy)methyl]undecyl]-3-fluorobenzene |
| SMILES | CCCCCCCCC(CCc1cccc(F)c1)C(OC)(OC)OC(C)C |
| InChI | InChI=1S/C23H39FO3/c1-6-7-8-9-10-11-14-21(23(25-4,26-5)27-19(2)3)17-16-20-13-12-15-22(24)18-20/h12-13,15,18-19,21H,6-11,14,16-17H2,1-5H3 |
| InChIKey | ZSWSUDSZMLZRFG-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|