C21H33F3O — CID 151889153
1,2,3-trifluoro-5-[3-(2-methoxypropan-2-yl)undecyl]benzene (PubChem CID 151889153) has the molecular formula C21H33F3O and a molecular weight of 358.49 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[3-(2-methoxypropan-2-yl)undecyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[3-(2-methoxypropan-2-yl)undecyl]benzene |
|---|---|
| PubChem CID | 151889153 |
| Molecular Formula | C21H33F3O |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 1,2,3-trifluoro-5-[3-(2-methoxypropan-2-yl)undecyl]benzene |
| SMILES | CCCCCCCCC(CCc1cc(F)c(F)c(F)c1)C(C)(C)OC |
| InChI | InChI=1S/C21H33F3O/c1-5-6-7-8-9-10-11-17(21(2,3)25-4)13-12-16-14-18(22)20(24)19(23)15-16/h14-15,17H,5-13H2,1-4H3 |
| InChIKey | SQJDHUBCDSANPE-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|