C20H29F5O2 — CID 150070141
1,2,3,4,5-pentafluoro-6-[2-(2-methoxypropan-2-yl)decoxy]benzene (PubChem CID 150070141) has the molecular formula C20H29F5O2 and a molecular weight of 396.44 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[2-(2-methoxypropan-2-yl)decoxy]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[2-(2-methoxypropan-2-yl)decoxy]benzene |
|---|---|
| PubChem CID | 150070141 |
| Molecular Formula | C20H29F5O2 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[2-(2-methoxypropan-2-yl)decoxy]benzene |
| SMILES | CCCCCCCCC(COc1c(F)c(F)c(F)c(F)c1F)C(C)(C)OC |
| InChI | InChI=1S/C20H29F5O2/c1-5-6-7-8-9-10-11-13(20(2,3)26-4)12-27-19-17(24)15(22)14(21)16(23)18(19)25/h13H,5-12H2,1-4H3 |
| InChIKey | DPCFZVYDGZLXQS-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|