C30H49F5O2 — CID 151173394
1-[11-(1,1-dimethoxypropyl)nonadecyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 151173394) has the molecular formula C30H49F5O2 and a molecular weight of 536.71 g/mol. Its IUPAC name is 1-[11-(1,1-dimethoxypropyl)nonadecyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[11-(1,1-dimethoxypropyl)nonadecyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 151173394 |
| Molecular Formula | C30H49F5O2 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.37 |
| IUPAC Name | 1-[11-(1,1-dimethoxypropyl)nonadecyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | CCCCCCCCC(CCCCCCCCCCc1c(F)c(F)c(F)c(F)c1F)C(CC)(OC)OC |
| InChI | InChI=1S/C30H49F5O2/c1-5-7-8-9-14-17-20-23(30(6-2,36-3)37-4)21-18-15-12-10-11-13-16-19-22-24-25(31)27(33)29(35)28(34)26(24)32/h23H,5-22H2,1-4H3 |
| InChIKey | NCTJOVIQZQAZFP-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|