C21H32F4O2 — CID 172834419
1-[2-(1,1-dimethoxypropyl)decyl]-2,3,4,5-tetrafluorobenzene (PubChem CID 172834419) has the molecular formula C21H32F4O2 and a molecular weight of 392.48 g/mol. Its IUPAC name is 1-[2-(1,1-dimethoxypropyl)decyl]-2,3,4,5-tetrafluorobenzene.
| Compound Name | 1-[2-(1,1-dimethoxypropyl)decyl]-2,3,4,5-tetrafluorobenzene |
|---|---|
| PubChem CID | 172834419 |
| Molecular Formula | C21H32F4O2 |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 1-[2-(1,1-dimethoxypropyl)decyl]-2,3,4,5-tetrafluorobenzene |
| SMILES | CCCCCCCCC(Cc1cc(F)c(F)c(F)c1F)C(CC)(OC)OC |
| InChI | InChI=1S/C21H32F4O2/c1-5-7-8-9-10-11-12-16(21(6-2,26-3)27-4)13-15-14-17(22)19(24)20(25)18(15)23/h14,16H,5-13H2,1-4H3 |
| InChIKey | VYNYXCXXPVOJQD-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|