C24H39F3O2 — CID 152548606
1-[4-(1,1-dimethoxypropyl)dodecyl]-4-(trifluoromethyl)benzene (PubChem CID 152548606) has the molecular formula C24H39F3O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is 1-[4-(1,1-dimethoxypropyl)dodecyl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[4-(1,1-dimethoxypropyl)dodecyl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 152548606 |
| Molecular Formula | C24H39F3O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | 1-[4-(1,1-dimethoxypropyl)dodecyl]-4-(trifluoromethyl)benzene |
| SMILES | CCCCCCCCC(CCCc1ccc(C(F)(F)F)cc1)C(CC)(OC)OC |
| InChI | InChI=1S/C24H39F3O2/c1-5-7-8-9-10-11-14-21(23(6-2,28-3)29-4)15-12-13-20-16-18-22(19-17-20)24(25,26)27/h16-19,21H,5-15H2,1-4H3 |
| InChIKey | YMZUMDUQLCGRGP-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|