C23H38F2O3 — CID 152503932
2-[3-(3,4-difluorophenyl)propyl]-1,1-diethoxydecan-1-ol (PubChem CID 152503932) has the molecular formula C23H38F2O3 and a molecular weight of 400.55 g/mol. Its IUPAC name is 2-[3-(3,4-difluorophenyl)propyl]-1,1-diethoxydecan-1-ol.
| Compound Name | 2-[3-(3,4-difluorophenyl)propyl]-1,1-diethoxydecan-1-ol |
|---|---|
| PubChem CID | 152503932 |
| Molecular Formula | C23H38F2O3 |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 2-[3-(3,4-difluorophenyl)propyl]-1,1-diethoxydecan-1-ol |
| SMILES | CCCCCCCCC(CCCc1ccc(F)c(F)c1)C(O)(OCC)OCC |
| InChI | InChI=1S/C23H38F2O3/c1-4-7-8-9-10-11-14-20(23(26,27-5-2)28-6-3)15-12-13-19-16-17-21(24)22(25)18-19/h16-18,20,26H,4-15H2,1-3H3 |
| InChIKey | YEBBQKUJVNNVJY-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|