C17H36O3S — CID 150178419
1,1-diethoxy-2-(3-sulfanylpropyl)decan-1-ol (PubChem CID 150178419) has the molecular formula C17H36O3S and a molecular weight of 320.54 g/mol. Its IUPAC name is 1,1-diethoxy-2-(3-sulfanylpropyl)decan-1-ol.
| Compound Name | 1,1-diethoxy-2-(3-sulfanylpropyl)decan-1-ol |
|---|---|
| PubChem CID | 150178419 |
| Molecular Formula | C17H36O3S |
| Molecular Weight | 320.54 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 1,1-diethoxy-2-(3-sulfanylpropyl)decan-1-ol |
| SMILES | CCCCCCCCC(CCCS)C(O)(OCC)OCC |
| InChI | InChI=1S/C17H36O3S/c1-4-7-8-9-10-11-13-16(14-12-15-21)17(18,19-5-2)20-6-3/h16,18,21H,4-15H2,1-3H3 |
| InChIKey | FKXCCGWEWMDGQC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|