C25H39F5N2O4 — CID 151465673
1-[5-[diethoxy(hydroxy)methyl]tridecyl]-3-(2,3,4,5,6-pentafluorophenyl)urea (PubChem CID 151465673) has the molecular formula C25H39F5N2O4 and a molecular weight of 526.59 g/mol. Its IUPAC name is 1-[5-[diethoxy(hydroxy)methyl]tridecyl]-3-(2,3,4,5,6-pentafluorophenyl)urea.
| Compound Name | 1-[5-[diethoxy(hydroxy)methyl]tridecyl]-3-(2,3,4,5,6-pentafluorophenyl)urea |
|---|---|
| PubChem CID | 151465673 |
| Molecular Formula | C25H39F5N2O4 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | 1-[5-[diethoxy(hydroxy)methyl]tridecyl]-3-(2,3,4,5,6-pentafluorophenyl)urea |
| SMILES | CCCCCCCCC(CCCCNC(=O)Nc1c(F)c(F)c(F)c(F)c1F)C(O)(OCC)OCC |
| InChI | InChI=1S/C25H39F5N2O4/c1-4-7-8-9-10-11-14-17(25(34,35-5-2)36-6-3)15-12-13-16-31-24(33)32-23-21(29)19(27)18(26)20(28)22(23)30/h17,34H,4-16H2,1-3H3,(H2,31,32,33) |
| InChIKey | PJJSNYAEIHLFQR-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|