C28H44F6O3 — CID 151450760
2-[4-[3,5-bis(trifluoromethyl)phenyl]butyl]-1,1-di(propan-2-yloxy)decan-1-ol (PubChem CID 151450760) has the molecular formula C28H44F6O3 and a molecular weight of 542.65 g/mol. Its IUPAC name is 2-[4-[3,5-bis(trifluoromethyl)phenyl]butyl]-1,1-di(propan-2-yloxy)decan-1-ol.
| Compound Name | 2-[4-[3,5-bis(trifluoromethyl)phenyl]butyl]-1,1-di(propan-2-yloxy)decan-1-ol |
|---|---|
| PubChem CID | 151450760 |
| Molecular Formula | C28H44F6O3 |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.32 |
| IUPAC Name | 2-[4-[3,5-bis(trifluoromethyl)phenyl]butyl]-1,1-di(propan-2-yloxy)decan-1-ol |
| SMILES | CCCCCCCCC(CCCCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C28H44F6O3/c1-6-7-8-9-10-11-15-23(28(35,36-20(2)3)37-21(4)5)16-13-12-14-22-17-24(26(29,30)31)19-25(18-22)27(32,33)34/h17-21,23,35H,6-16H2,1-5H3 |
| InChIKey | PGLDBSLFTCPDOJ-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|