About (2R)-2-phenylheptan-3-ol
(2R)-2-phenylheptan-3-ol (PubChem CID 91322845) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is (2R)-2-phenylheptan-3-ol.
Molecular Properties
| Compound Name | (2R)-2-phenylheptan-3-ol |
| PubChem CID | 91322845 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (2R)-2-phenylheptan-3-ol |
| SMILES | CCCCC(O)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C13H20O/c1-3-4-10-13(14)11(2)12-8-6-5-7-9-12/h5-9,11,13-14H,3-4,10H2,1-2H3/t11-,13?/m1/s1 |
| InChIKey | XHJPWJPKYQJVFO-JTDNENJMSA-N |
| XLogP | 3.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-2-phenylheptan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-phenylheptan-3-ol?
The IUPAC name of (2R)-2-phenylheptan-3-ol (CID 91322845) is (2R)-2-phenylheptan-3-ol.
What is the SMILES notation for (2R)-2-phenylheptan-3-ol?
The canonical SMILES for (2R)-2-phenylheptan-3-ol is CCCCC(O)[C@H](C)c1ccccc1.
What is the InChIKey of (2R)-2-phenylheptan-3-ol?
The InChIKey is XHJPWJPKYQJVFO-JTDNENJMSA-N. The full InChI is InChI=1S/C13H20O/c1-3-4-10-13(14)11(2)12-8-6-5-7-9-12/h5-9,11,13-14H,3-4,10H2,1-2H3/t11-,13?/m1/s1.
What are the key properties of (2R)-2-phenylheptan-3-ol?
(2R)-2-phenylheptan-3-ol has a molecular weight of 192.30 g/mol, XLogP of 3.34, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-phenylheptan-3-ol is sourced from PubChem (CID 91322845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).