C17H26O3 — CID 15605723
methyl (2S,3S)-3-hydroxy-2-[(1S)-1-phenylethyl]octanoate (PubChem CID 15605723) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is methyl (2S,3S)-3-hydroxy-2-[(1S)-1-phenylethyl]octanoate.
| Compound Name | methyl (2S,3S)-3-hydroxy-2-[(1S)-1-phenylethyl]octanoate |
|---|---|
| PubChem CID | 15605723 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | methyl (2S,3S)-3-hydroxy-2-[(1S)-1-phenylethyl]octanoate |
| SMILES | CCCCC[C@H](O)[C@@H](C(=O)OC)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C17H26O3/c1-4-5-7-12-15(18)16(17(19)20-3)13(2)14-10-8-6-9-11-14/h6,8-11,13,15-16,18H,4-5,7,12H2,1-3H3/t13-,15+,16+/m1/s1 |
| InChIKey | IQPOQSNMBNNHGB-KBMXLJTQSA-N |
| XLogP | 3.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|