C18H20O3 — CID 101428067
methyl (2S,3S)-2-[(R)-hydroxy(phenyl)methyl]-3-phenylbutanoate (PubChem CID 101428067) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is methyl (2S,3S)-2-[(R)-hydroxy(phenyl)methyl]-3-phenylbutanoate.
| Compound Name | methyl (2S,3S)-2-[(R)-hydroxy(phenyl)methyl]-3-phenylbutanoate |
|---|---|
| PubChem CID | 101428067 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | methyl (2S,3S)-2-[(R)-hydroxy(phenyl)methyl]-3-phenylbutanoate |
| SMILES | COC(=O)[C@@H]([C@H](C)c1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H20O3/c1-13(14-9-5-3-6-10-14)16(18(20)21-2)17(19)15-11-7-4-8-12-15/h3-13,16-17,19H,1-2H3/t13-,16+,17+/m1/s1 |
| InChIKey | VRMKPODTSJKWMP-COXVUDFISA-N |
| XLogP | 3.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |