C21H26O3S — CID 100933056
methyl (2R,3S)-2-[hydroxy(phenyl)methyl]-3-phenylsulfanylheptanoate (PubChem CID 100933056) has the molecular formula C21H26O3S and a molecular weight of 358.50 g/mol. Its IUPAC name is methyl (2R,3S)-2-[hydroxy(phenyl)methyl]-3-phenylsulfanylheptanoate.
| Compound Name | methyl (2R,3S)-2-[hydroxy(phenyl)methyl]-3-phenylsulfanylheptanoate |
|---|---|
| PubChem CID | 100933056 |
| Molecular Formula | C21H26O3S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | methyl (2R,3S)-2-[hydroxy(phenyl)methyl]-3-phenylsulfanylheptanoate |
| SMILES | CCCC[C@H](Sc1ccccc1)[C@@H](C(=O)OC)C(O)c1ccccc1 |
| InChI | InChI=1S/C21H26O3S/c1-3-4-15-18(25-17-13-9-6-10-14-17)19(21(23)24-2)20(22)16-11-7-5-8-12-16/h5-14,18-20,22H,3-4,15H2,1-2H3/t18-,19+,20?/m0/s1 |
| InChIKey | LYLCYNULVRSVEZ-ABZYKWASSA-N |
| XLogP | 4.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |