(2S,3R)-2-hydroxy-3-phenylsulfanylheptanoic acid

C13H18O3S — CID 10682384

IUPAC(2S,3R)-2-hydroxy-3-phenylsulfanylheptanoic acid
SMILESCCCC[C@@H](Sc1ccccc1)[C@@H](O)C(=O)O
InChIInChI=1S/C13H18O3S/c1-2-3-9-11(12(14)13(15)16)17-10-7-5-4-6-8-10/h4-8,11-12,14H,2-3,9H2,1H3,(H,15,16)/t11-,12-/m1/s1
InChIKeyRWIJVSHCDBGXHN-VXGBXAGGSA-N
MW254.35 g/mol
LogP2.78
Rot. Bonds7

About (2S,3R)-2-hydroxy-3-phenylsulfanylheptanoic acid

(2S,3R)-2-hydroxy-3-phenylsulfanylheptanoic acid (PubChem CID 10682384) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is (2S,3R)-2-hydroxy-3-phenylsulfanylheptanoic acid.

Molecular Properties

Compound Name(2S,3R)-2-hydroxy-3-phenylsulfanylheptanoic acid
PubChem CID10682384
Molecular FormulaC13H18O3S
Molecular Weight254.35 g/mol
Exact Mass254.10
IUPAC Name(2S,3R)-2-hydroxy-3-phenylsulfanylheptanoic acid
SMILESCCCC[C@@H](Sc1ccccc1)[C@@H](O)C(=O)O
InChIInChI=1S/C13H18O3S/c1-2-3-9-11(12(14)13(15)16)17-10-7-5-4-6-8-10/h4-8,11-12,14H,2-3,9H2,1H3,(H,15,16)/t11-,12-/m1/s1
InChIKeyRWIJVSHCDBGXHN-VXGBXAGGSA-N
XLogP2.78
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.35
LogP ≤ 52.78
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2S,3R)-2-hydroxy-3-phenylsulfanylheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3R)-2-hydroxy-3-phenylsulfanylheptanoic acid?
The IUPAC name of (2S,3R)-2-hydroxy-3-phenylsulfanylheptanoic acid (CID 10682384) is (2S,3R)-2-hydroxy-3-phenylsulfanylheptanoic acid.
What is the SMILES notation for (2S,3R)-2-hydroxy-3-phenylsulfanylheptanoic acid?
The canonical SMILES for (2S,3R)-2-hydroxy-3-phenylsulfanylheptanoic acid is CCCC[C@@H](Sc1ccccc1)[C@@H](O)C(=O)O.
What is the InChIKey of (2S,3R)-2-hydroxy-3-phenylsulfanylheptanoic acid?
The InChIKey is RWIJVSHCDBGXHN-VXGBXAGGSA-N. The full InChI is InChI=1S/C13H18O3S/c1-2-3-9-11(12(14)13(15)16)17-10-7-5-4-6-8-10/h4-8,11-12,14H,2-3,9H2,1H3,(H,15,16)/t11-,12-/m1/s1.
What are the key properties of (2S,3R)-2-hydroxy-3-phenylsulfanylheptanoic acid?
(2S,3R)-2-hydroxy-3-phenylsulfanylheptanoic acid has a molecular weight of 254.35 g/mol, XLogP of 2.78, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-2-hydroxy-3-phenylsulfanylheptanoic acid is sourced from PubChem (CID 10682384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).