C13H18O2S — CID 57359587
2-phenylsulfanylheptanoic acid (PubChem CID 57359587) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is 2-phenylsulfanylheptanoic acid.
| Compound Name | 2-phenylsulfanylheptanoic acid |
|---|---|
| PubChem CID | 57359587 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-phenylsulfanylheptanoic acid |
| SMILES | CCCCCC(Sc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H18O2S/c1-2-3-5-10-12(13(14)15)16-11-8-6-4-7-9-11/h4,6-9,12H,2-3,5,10H2,1H3,(H,14,15) |
| InChIKey | SOCVTAHOHCINDZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|