C21H34O3S — CID 21449445
2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylheptanoic acid (PubChem CID 21449445) has the molecular formula C21H34O3S and a molecular weight of 366.57 g/mol. Its IUPAC name is 2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylheptanoic acid.
| Compound Name | 2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylheptanoic acid |
|---|---|
| PubChem CID | 21449445 |
| Molecular Formula | C21H34O3S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylheptanoic acid |
| SMILES | CCCCCC(Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(=O)O |
| InChI | InChI=1S/C21H34O3S/c1-8-9-10-11-17(19(23)24)25-14-12-15(20(2,3)4)18(22)16(13-14)21(5,6)7/h12-13,17,22H,8-11H2,1-7H3,(H,23,24) |
| InChIKey | USWXQWODEGJPLW-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|