C20H32O2S — CID 15555175
2-phenylsulfanyltetradecanoic acid (PubChem CID 15555175) has the molecular formula C20H32O2S and a molecular weight of 336.54 g/mol. Its IUPAC name is 2-phenylsulfanyltetradecanoic acid.
| Compound Name | 2-phenylsulfanyltetradecanoic acid |
|---|---|
| PubChem CID | 15555175 |
| Molecular Formula | C20H32O2S |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 2-phenylsulfanyltetradecanoic acid |
| SMILES | CCCCCCCCCCCCC(Sc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H32O2S/c1-2-3-4-5-6-7-8-9-10-14-17-19(20(21)22)23-18-15-12-11-13-16-18/h11-13,15-16,19H,2-10,14,17H2,1H3,(H,21,22) |
| InChIKey | AVAGAJAEWNVBPD-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|