C18H28O3S — CID 21449439
2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylbutanoic acid (PubChem CID 21449439) has the molecular formula C18H28O3S and a molecular weight of 324.49 g/mol. Its IUPAC name is 2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylbutanoic acid.
| Compound Name | 2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylbutanoic acid |
|---|---|
| PubChem CID | 21449439 |
| Molecular Formula | C18H28O3S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylbutanoic acid |
| SMILES | CCC(Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(=O)O |
| InChI | InChI=1S/C18H28O3S/c1-8-14(16(20)21)22-11-9-12(17(2,3)4)15(19)13(10-11)18(5,6)7/h9-10,14,19H,8H2,1-7H3,(H,20,21) |
| InChIKey | OQGQYOUCVSVKMR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |