C17H24O3S — CID 14796232
(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylprop-2-enoic acid (PubChem CID 14796232) has the molecular formula C17H24O3S and a molecular weight of 308.44 g/mol. Its IUPAC name is (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylprop-2-enoic acid.
| Compound Name | (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylprop-2-enoic acid |
|---|---|
| PubChem CID | 14796232 |
| Molecular Formula | C17H24O3S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylprop-2-enoic acid |
| SMILES | CC(C)(C)c1cc(S/C=C/C(=O)O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C17H24O3S/c1-16(2,3)12-9-11(21-8-7-14(18)19)10-13(15(12)20)17(4,5)6/h7-10,20H,1-6H3,(H,18,19)/b8-7+ |
| InChIKey | IBECKWSHDKFRAX-BQYQJAHWSA-N |
| XLogP | 4.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|