C37H56O5S2 — CID 139905936
2-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenyl]-2-propylpropanedioic acid (PubChem CID 139905936) has the molecular formula C37H56O5S2 and a molecular weight of 644.98 g/mol. Its IUPAC name is 2-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenyl]-2-propylpropanedioic acid.
| Compound Name | 2-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenyl]-2-propylpropanedioic acid |
|---|---|
| PubChem CID | 139905936 |
| Molecular Formula | C37H56O5S2 |
| Molecular Weight | 644.98 g/mol |
| Exact Mass | 644.36 |
| IUPAC Name | 2-[2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylpropan-2-ylsulfanyl]phenyl]-2-propylpropanedioic acid |
| SMILES | CCCC(C(=O)O)(C(=O)O)c1c(C(C)(C)C)cc(SC(C)(C)Sc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C37H56O5S2/c1-16-17-37(30(39)40,31(41)42)28-24(32(2,3)4)18-22(19-25(28)33(5,6)7)43-36(14,15)44-23-20-26(34(8,9)10)29(38)27(21-23)35(11,12)13/h18-21,38H,16-17H2,1-15H3,(H,39,40)(H,41,42) |
| InChIKey | SUIBJUOCPXQTMI-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.98 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|