About ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-2-methylpropyl]sulfanylacetate
ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-2-methylpropyl]sulfanylacetate (PubChem CID 139673761) has the molecular formula C22H36O3S2
and a molecular weight of 412.66 g/mol. Its IUPAC name is ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-2-methylpropyl]sulfanylacetate.
Molecular Properties
| Compound Name | ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-2-methylpropyl]sulfanylacetate |
| PubChem CID | 139673761 |
| Molecular Formula | C22H36O3S2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-2-methylpropyl]sulfanylacetate |
| SMILES | CCOC(=O)CSCC(C)(C)Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H36O3S2/c1-10-25-18(23)13-26-14-22(8,9)27-15-11-16(20(2,3)4)19(24)17(12-15)21(5,6)7/h11-12,24H,10,13-14H2,1-9H3 |
| InChIKey | DUXXVSXYSVVXFI-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-2-methylpropyl]sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-2-methylpropyl]sulfanylacetate?
The IUPAC name of ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-2-methylpropyl]sulfanylacetate (CID 139673761) is ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-2-methylpropyl]sulfanylacetate.
What is the SMILES notation for ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-2-methylpropyl]sulfanylacetate?
The canonical SMILES for ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-2-methylpropyl]sulfanylacetate is CCOC(=O)CSCC(C)(C)Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.
What is the InChIKey of ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-2-methylpropyl]sulfanylacetate?
The InChIKey is DUXXVSXYSVVXFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36O3S2/c1-10-25-18(23)13-26-14-22(8,9)27-15-11-16(20(2,3)4)19(24)17(12-15)21(5,6)7/h11-12,24H,10,13-14H2,1-9H3.
What are the key properties of ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-2-methylpropyl]sulfanylacetate?
ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-2-methylpropyl]sulfanylacetate has a molecular weight of 412.66 g/mol, XLogP of 6.15, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-2-methylpropyl]sulfanylacetate is sourced from PubChem (CID 139673761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).