C32H38O7S — CID 98127585
ethyl 2-[1,4-diacetyloxy-3-(3,5-ditert-butyl-4-hydroxyphenyl)naphthalen-2-yl]sulfanylacetate (PubChem CID 98127585) has the molecular formula C32H38O7S and a molecular weight of 566.72 g/mol. Its IUPAC name is ethyl 2-[1,4-diacetyloxy-3-(3,5-ditert-butyl-4-hydroxyphenyl)naphthalen-2-yl]sulfanylacetate.
| Compound Name | ethyl 2-[1,4-diacetyloxy-3-(3,5-ditert-butyl-4-hydroxyphenyl)naphthalen-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 98127585 |
| Molecular Formula | C32H38O7S |
| Molecular Weight | 566.72 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | ethyl 2-[1,4-diacetyloxy-3-(3,5-ditert-butyl-4-hydroxyphenyl)naphthalen-2-yl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1c(-c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c(OC(C)=O)c2ccccc2c1OC(C)=O |
| InChI | InChI=1S/C32H38O7S/c1-10-37-25(35)17-40-30-26(20-15-23(31(4,5)6)27(36)24(16-20)32(7,8)9)28(38-18(2)33)21-13-11-12-14-22(21)29(30)39-19(3)34/h11-16,36H,10,17H2,1-9H3 |
| InChIKey | JCULEHIARDQLOY-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.72 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|