C22H36O5 — CID 158750681
(3,5-ditert-butyl-4-hydroxyphenyl) 2-methylpropanoate;ethyl acetate (PubChem CID 158750681) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxyphenyl) 2-methylpropanoate;ethyl acetate.
| Compound Name | (3,5-ditert-butyl-4-hydroxyphenyl) 2-methylpropanoate;ethyl acetate |
|---|---|
| PubChem CID | 158750681 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxyphenyl) 2-methylpropanoate;ethyl acetate |
| SMILES | CC(C)C(=O)Oc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.CCOC(C)=O |
| InChI | InChI=1S/C18H28O3.C4H8O2/c1-11(2)16(20)21-12-9-13(17(3,4)5)15(19)14(10-12)18(6,7)8;1-3-6-4(2)5/h9-11,19H,1-8H3;3H2,1-2H3 |
| InChIKey | INLCJKLRSIDDMW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|