C17H25NO4 — CID 174570996
(3,5-ditert-butyl-4-hydroxyphenyl) acetate;isocyanic acid (PubChem CID 174570996) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxyphenyl) acetate;isocyanic acid.
| Compound Name | (3,5-ditert-butyl-4-hydroxyphenyl) acetate;isocyanic acid |
|---|---|
| PubChem CID | 174570996 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxyphenyl) acetate;isocyanic acid |
| SMILES | CC(=O)Oc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.N=C=O |
| InChI | InChI=1S/C16H24O3.CHNO/c1-10(17)19-11-8-12(15(2,3)4)14(18)13(9-11)16(5,6)7;2-1-3/h8-9,18H,1-7H3;2H |
| InChIKey | LHZASONBBSULNP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|