C20H32O4S — CID 88504067
[(2R)-2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylbutan-2-yl] ethaneperoxoate (PubChem CID 88504067) has the molecular formula C20H32O4S and a molecular weight of 368.54 g/mol. Its IUPAC name is [(2R)-2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylbutan-2-yl] ethaneperoxoate.
| Compound Name | [(2R)-2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylbutan-2-yl] ethaneperoxoate |
|---|---|
| PubChem CID | 88504067 |
| Molecular Formula | C20H32O4S |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | [(2R)-2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylbutan-2-yl] ethaneperoxoate |
| SMILES | CC[C@](C)(OOC(C)=O)Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H32O4S/c1-10-20(9,24-23-13(2)21)25-14-11-15(18(3,4)5)17(22)16(12-14)19(6,7)8/h11-12,22H,10H2,1-9H3/t20-/m1/s1 |
| InChIKey | PXZBKJICZNAEOG-HXUWFJFHSA-N |
| XLogP | 5.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|