C33H52O2S2 — CID 143127523
2,6-ditert-butyl-4-[2-[3-tert-butyl-4-hydroxy-5-(2-methylbutan-2-yl)phenyl]sulfanylbutan-2-ylsulfanyl]phenol (PubChem CID 143127523) has the molecular formula C33H52O2S2 and a molecular weight of 544.91 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[2-[3-tert-butyl-4-hydroxy-5-(2-methylbutan-2-yl)phenyl]sulfanylbutan-2-ylsulfanyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[2-[3-tert-butyl-4-hydroxy-5-(2-methylbutan-2-yl)phenyl]sulfanylbutan-2-ylsulfanyl]phenol |
|---|---|
| PubChem CID | 143127523 |
| Molecular Formula | C33H52O2S2 |
| Molecular Weight | 544.91 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | 2,6-ditert-butyl-4-[2-[3-tert-butyl-4-hydroxy-5-(2-methylbutan-2-yl)phenyl]sulfanylbutan-2-ylsulfanyl]phenol |
| SMILES | CCC(C)(Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)Sc1cc(C(C)(C)C)c(O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C33H52O2S2/c1-15-32(12,13)26-20-22(19-25(28(26)35)31(9,10)11)37-33(14,16-2)36-21-17-23(29(3,4)5)27(34)24(18-21)30(6,7)8/h17-20,34-35H,15-16H2,1-14H3 |
| InChIKey | FGLKNQFIPFOAMA-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.91 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|