C39H64O5S2 — CID 143127512
5-[2-tert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylbutan-2-ylsulfanyl]phenoxy]-5-oxopentanoic acid;ethane;2-methylpropane (PubChem CID 143127512) has the molecular formula C39H64O5S2 and a molecular weight of 677.07 g/mol. Its IUPAC name is 5-[2-tert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylbutan-2-ylsulfanyl]phenoxy]-5-oxopentanoic acid;ethane;2-methylpropane.
| Compound Name | 5-[2-tert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylbutan-2-ylsulfanyl]phenoxy]-5-oxopentanoic acid;ethane;2-methylpropane |
|---|---|
| PubChem CID | 143127512 |
| Molecular Formula | C39H64O5S2 |
| Molecular Weight | 677.07 g/mol |
| Exact Mass | 676.42 |
| IUPAC Name | 5-[2-tert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)sulfanylbutan-2-ylsulfanyl]phenoxy]-5-oxopentanoic acid;ethane;2-methylpropane |
| SMILES | CC.CC(C)C.CCC(C)(Sc1ccc(OC(=O)CCCC(=O)O)c(C(C)(C)C)c1)Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H48O5S2.C4H10.C2H6/c1-12-33(11,40-22-19-24(31(5,6)7)29(37)25(20-22)32(8,9)10)39-21-16-17-26(23(18-21)30(2,3)4)38-28(36)15-13-14-27(34)35;1-4(2)3;1-2/h16-20,37H,12-15H2,1-11H3,(H,34,35);4H,1-3H3;1-2H3 |
| InChIKey | WTEDLCZUOGWIDY-UHFFFAOYSA-N |
| XLogP | 12.14 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.07 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|