C36H54O5S2 — CID 143127503
4-[2-tert-butyl-4-[2-(3-tert-butyl-4-hydroxy-5-propan-2-ylphenyl)sulfanylbutan-2-ylsulfanyl]-6-(2,2-dimethylpropyl)phenoxy]-4-oxobutanoic acid (PubChem CID 143127503) has the molecular formula C36H54O5S2 and a molecular weight of 630.96 g/mol. Its IUPAC name is 4-[2-tert-butyl-4-[2-(3-tert-butyl-4-hydroxy-5-propan-2-ylphenyl)sulfanylbutan-2-ylsulfanyl]-6-(2,2-dimethylpropyl)phenoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-tert-butyl-4-[2-(3-tert-butyl-4-hydroxy-5-propan-2-ylphenyl)sulfanylbutan-2-ylsulfanyl]-6-(2,2-dimethylpropyl)phenoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 143127503 |
| Molecular Formula | C36H54O5S2 |
| Molecular Weight | 630.96 g/mol |
| Exact Mass | 630.34 |
| IUPAC Name | 4-[2-tert-butyl-4-[2-(3-tert-butyl-4-hydroxy-5-propan-2-ylphenyl)sulfanylbutan-2-ylsulfanyl]-6-(2,2-dimethylpropyl)phenoxy]-4-oxobutanoic acid |
| SMILES | CCC(C)(Sc1cc(C(C)C)c(O)c(C(C)(C)C)c1)Sc1cc(CC(C)(C)C)c(OC(=O)CCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H54O5S2/c1-14-36(13,43-25-18-26(22(2)3)31(40)27(19-25)34(7,8)9)42-24-17-23(21-33(4,5)6)32(28(20-24)35(10,11)12)41-30(39)16-15-29(37)38/h17-20,22,40H,14-16,21H2,1-13H3,(H,37,38) |
| InChIKey | DESIFWXEZRZPOS-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.96 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|