About 4-[2,6-ditert-butyl-4-[[furan-2-yl(dimethyl)silyl]methylsulfanyl]phenoxy]-4-oxobutanoic acid
4-[2,6-ditert-butyl-4-[[furan-2-yl(dimethyl)silyl]methylsulfanyl]phenoxy]-4-oxobutanoic acid (PubChem CID 139913438) has the molecular formula C25H36O5SSi
and a molecular weight of 476.71 g/mol. Its IUPAC name is 4-[2,6-ditert-butyl-4-[[furan-2-yl(dimethyl)silyl]methylsulfanyl]phenoxy]-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[2,6-ditert-butyl-4-[[furan-2-yl(dimethyl)silyl]methylsulfanyl]phenoxy]-4-oxobutanoic acid |
| PubChem CID | 139913438 |
| Molecular Formula | C25H36O5SSi |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 4-[2,6-ditert-butyl-4-[[furan-2-yl(dimethyl)silyl]methylsulfanyl]phenoxy]-4-oxobutanoic acid |
| SMILES | CC(C)(C)c1cc(SC[Si](C)(C)c2ccco2)cc(C(C)(C)C)c1OC(=O)CCC(=O)O |
| InChI | InChI=1S/C25H36O5SSi/c1-24(2,3)18-14-17(31-16-32(7,8)22-10-9-13-29-22)15-19(25(4,5)6)23(18)30-21(28)12-11-20(26)27/h9-10,13-15H,11-12,16H2,1-8H3,(H,26,27) |
| InChIKey | WLPVYHMJPIQNFB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,6-ditert-butyl-4-[[furan-2-yl(dimethyl)silyl]methylsulfanyl]phenoxy]-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,6-ditert-butyl-4-[[furan-2-yl(dimethyl)silyl]methylsulfanyl]phenoxy]-4-oxobutanoic acid?
The IUPAC name of 4-[2,6-ditert-butyl-4-[[furan-2-yl(dimethyl)silyl]methylsulfanyl]phenoxy]-4-oxobutanoic acid (CID 139913438) is 4-[2,6-ditert-butyl-4-[[furan-2-yl(dimethyl)silyl]methylsulfanyl]phenoxy]-4-oxobutanoic acid.
What is the SMILES notation for 4-[2,6-ditert-butyl-4-[[furan-2-yl(dimethyl)silyl]methylsulfanyl]phenoxy]-4-oxobutanoic acid?
The canonical SMILES for 4-[2,6-ditert-butyl-4-[[furan-2-yl(dimethyl)silyl]methylsulfanyl]phenoxy]-4-oxobutanoic acid is CC(C)(C)c1cc(SC[Si](C)(C)c2ccco2)cc(C(C)(C)C)c1OC(=O)CCC(=O)O.
What is the InChIKey of 4-[2,6-ditert-butyl-4-[[furan-2-yl(dimethyl)silyl]methylsulfanyl]phenoxy]-4-oxobutanoic acid?
The InChIKey is WLPVYHMJPIQNFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H36O5SSi/c1-24(2,3)18-14-17(31-16-32(7,8)22-10-9-13-29-22)15-19(25(4,5)6)23(18)30-21(28)12-11-20(26)27/h9-10,13-15H,11-12,16H2,1-8H3,(H,26,27).
What are the key properties of 4-[2,6-ditert-butyl-4-[[furan-2-yl(dimethyl)silyl]methylsulfanyl]phenoxy]-4-oxobutanoic acid?
4-[2,6-ditert-butyl-4-[[furan-2-yl(dimethyl)silyl]methylsulfanyl]phenoxy]-4-oxobutanoic acid has a molecular weight of 476.71 g/mol, XLogP of 5.89, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,6-ditert-butyl-4-[[furan-2-yl(dimethyl)silyl]methylsulfanyl]phenoxy]-4-oxobutanoic acid is sourced from PubChem (CID 139913438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).