C25H36O5SSi — CID 139913438
4-[2,6-ditert-butyl-4-[[furan-2-yl(dimethyl)silyl]methylsulfanyl]phenoxy]-4-oxobutanoic acid (PubChem CID 139913438) has the molecular formula C25H36O5SSi and a molecular weight of 476.71 g/mol. Its IUPAC name is 4-[2,6-ditert-butyl-4-[[furan-2-yl(dimethyl)silyl]methylsulfanyl]phenoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2,6-ditert-butyl-4-[[furan-2-yl(dimethyl)silyl]methylsulfanyl]phenoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 139913438 |
| Molecular Formula | C25H36O5SSi |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 4-[2,6-ditert-butyl-4-[[furan-2-yl(dimethyl)silyl]methylsulfanyl]phenoxy]-4-oxobutanoic acid |
| SMILES | CC(C)(C)c1cc(SC[Si](C)(C)c2ccco2)cc(C(C)(C)C)c1OC(=O)CCC(=O)O |
| InChI | InChI=1S/C25H36O5SSi/c1-24(2,3)18-14-17(31-16-32(7,8)22-10-9-13-29-22)15-19(25(4,5)6)23(18)30-21(28)12-11-20(26)27/h9-10,13-15H,11-12,16H2,1-8H3,(H,26,27) |
| InChIKey | WLPVYHMJPIQNFB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|