C24H36O3SSi — CID 139913443
[2,6-ditert-butyl-4-[[dimethyl(thiophen-2-yl)silyl]methoxy]phenyl] propanoate (PubChem CID 139913443) has the molecular formula C24H36O3SSi and a molecular weight of 432.70 g/mol. Its IUPAC name is [2,6-ditert-butyl-4-[[dimethyl(thiophen-2-yl)silyl]methoxy]phenyl] propanoate.
| Compound Name | [2,6-ditert-butyl-4-[[dimethyl(thiophen-2-yl)silyl]methoxy]phenyl] propanoate |
|---|---|
| PubChem CID | 139913443 |
| Molecular Formula | C24H36O3SSi |
| Molecular Weight | 432.70 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | [2,6-ditert-butyl-4-[[dimethyl(thiophen-2-yl)silyl]methoxy]phenyl] propanoate |
| SMILES | CCC(=O)Oc1c(C(C)(C)C)cc(OC[Si](C)(C)c2cccs2)cc1C(C)(C)C |
| InChI | InChI=1S/C24H36O3SSi/c1-10-20(25)27-22-18(23(2,3)4)14-17(15-19(22)24(5,6)7)26-16-29(8,9)21-12-11-13-28-21/h11-15H,10,16H2,1-9H3 |
| InChIKey | QDYBLDUAIMBOPC-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.70 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|